C24H15ClN4O2 — CID 135436176
(3Z)-3-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one (PubChem CID 135436176) has the molecular formula C24H15ClN4O2 and a molecular weight of 426.86 g/mol. Its IUPAC name is (3Z)-3-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one.
| Compound Name | (3Z)-3-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one |
|---|---|
| PubChem CID | 135436176 |
| Molecular Formula | C24H15ClN4O2 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | (3Z)-3-[(4Z)-4-[(4-chlorophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=N/N1C(=O)/C(=C/c2ccc(Cl)cc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C24H15ClN4O2/c25-17-12-10-15(11-13-17)14-20-24(31)29(22(26-20)16-6-2-1-3-7-16)28-21-18-8-4-5-9-19(18)27-23(21)30/h1-14H,(H,27,28,30)/b20-14- |
| InChIKey | YMVOMHJCLBDHJY-ZHZULCJRSA-N |
| XLogP | 4.33 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|