C27H23N5O3 — CID 135884148
(3Z)-3-[4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-5-methoxy-1H-indol-2-one (PubChem CID 135884148) has the molecular formula C27H23N5O3 and a molecular weight of 465.51 g/mol. Its IUPAC name is (3Z)-3-[4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-5-methoxy-1H-indol-2-one.
| Compound Name | (3Z)-3-[4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-5-methoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 135884148 |
| Molecular Formula | C27H23N5O3 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | (3Z)-3-[4-[[4-(dimethylamino)phenyl]methylidene]-5-oxo-2-phenylimidazol-1-yl]imino-5-methoxy-1H-indol-2-one |
| SMILES | COc1ccc2c(c1)/C(=N/N1C(=O)C(=Cc3ccc(N(C)C)cc3)N=C1c1ccccc1)C(=O)N2 |
| InChI | InChI=1S/C27H23N5O3/c1-31(2)19-11-9-17(10-12-19)15-23-27(34)32(25(28-23)18-7-5-4-6-8-18)30-24-21-16-20(35-3)13-14-22(21)29-26(24)33/h4-16H,1-3H3,(H,29,30,33) |
| InChIKey | OQCAJJWLOKFFJX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|