C22H18N4O3 — CID 137205917
2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 137205917) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is 2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137205917 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[(4E)-4-[(4-methoxyphenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | COc1ccc(/C=C2/N=C(c3ccccc3)N(c3nc(C)cc(=O)[nH]3)C2=O)cc1 |
| InChI | InChI=1S/C22H18N4O3/c1-14-12-19(27)25-22(23-14)26-20(16-6-4-3-5-7-16)24-18(21(26)28)13-15-8-10-17(29-2)11-9-15/h3-13H,1-2H3,(H,23,25,27)/b18-13+ |
| InChIKey | SISYQOOKAASPRD-QGOAFFKASA-N |
| XLogP | 2.92 |
| TPSA | 87.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|