C23H18N2O5S — CID 6478456
[(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl] 4-methoxybenzenesulfonate (PubChem CID 6478456) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is [(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl] 4-methoxybenzenesulfonate.
| Compound Name | [(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 6478456 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [(4Z)-4-benzylidene-5-oxo-2-phenylimidazol-1-yl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)ON2C(=O)/C(=C/c3ccccc3)N=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18N2O5S/c1-29-19-12-14-20(15-13-19)31(27,28)30-25-22(18-10-6-3-7-11-18)24-21(23(25)26)16-17-8-4-2-5-9-17/h2-16H,1H3/b21-16- |
| InChIKey | CRZQFTCOTCLRHB-PGMHBOJBSA-N |
| XLogP | 3.65 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|