C19H25FeNO+2 — CID 154701298
cyclopentane;3-(cyclopentylmethylidene)-1H-indol-2-one;iron(2+) (PubChem CID 154701298) has the molecular formula C19H25FeNO+2 and a molecular weight of 339.26 g/mol. Its IUPAC name is cyclopentane;3-(cyclopentylmethylidene)-1H-indol-2-one;iron(2+).
| Compound Name | cyclopentane;3-(cyclopentylmethylidene)-1H-indol-2-one;iron(2+) |
|---|---|
| PubChem CID | 154701298 |
| Molecular Formula | C19H25FeNO+2 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | cyclopentane;3-(cyclopentylmethylidene)-1H-indol-2-one;iron(2+) |
| SMILES | C1CCCC1.O=C1Nc2ccccc2C1=CC1CCCC1.[Fe+2] |
| InChI | InChI=1S/C14H15NO.C5H10.Fe/c16-14-12(9-10-5-1-2-6-10)11-7-3-4-8-13(11)15-14;1-2-4-5-3-1;/h3-4,7-10H,1-2,5-6H2,(H,15,16);1-5H2;/q;;+2 |
| InChIKey | JGKCUURLEMXRGX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|