C16H15NO — CID 99935886
(3E)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylidene]-1H-indol-2-one (PubChem CID 99935886) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (3E)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 99935886 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (3E)-3-[[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccccc2/C1=C\[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H15NO/c18-16-14(13-3-1-2-4-15(13)17-16)9-12-8-10-5-6-11(12)7-10/h1-6,9-12H,7-8H2,(H,17,18)/b14-9+/t10-,11+,12+/m0/s1 |
| InChIKey | SHMJVHGBOKXAFD-WEHRVDLASA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|