C18H19NO — CID 2422561
(3E)-3-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]-1H-indol-2-one (PubChem CID 2422561) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (3E)-3-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]-1H-indol-2-one.
| Compound Name | (3E)-3-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 2422561 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (3E)-3-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]-1H-indol-2-one |
| SMILES | CC1(C)[C@H]2CC=C(/C=C3/C(=O)Nc4ccccc43)[C@@H]1C2 |
| InChI | InChI=1S/C18H19NO/c1-18(2)12-8-7-11(15(18)10-12)9-14-13-5-3-4-6-16(13)19-17(14)20/h3-7,9,12,15H,8,10H2,1-2H3,(H,19,20)/b14-9+/t12-,15-/m0/s1 |
| InChIKey | WLULRRHTVLBOIH-KTAQLRSZSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|