About CID 57369962
CID 57369962 (PubChem CID 57369962) has the molecular formula C19H15FeNO+2
and a molecular weight of 329.18 g/mol.
Molecular Properties
| Compound Name | CID 57369962 |
| PubChem CID | 57369962 |
| Molecular Formula | C19H15FeNO+2 |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ccccc2C1=C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H10NO.C5H5.Fe/c16-14-12(9-10-5-1-2-6-10)11-7-3-4-8-13(11)15-14;1-2-4-5-3-1;/h1-9H,(H,15,16);1-5H;/q;;+2 |
| InChIKey | DYTFZBUIGHNQBJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 57369962 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57369962?
The IUPAC name of CID 57369962 (CID 57369962) is not available.
What is the SMILES notation for CID 57369962?
The canonical SMILES for CID 57369962 is O=C1Nc2ccccc2C1=C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 57369962?
The InChIKey is DYTFZBUIGHNQBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10NO.C5H5.Fe/c16-14-12(9-10-5-1-2-6-10)11-7-3-4-8-13(11)15-14;1-2-4-5-3-1;/h1-9H,(H,15,16);1-5H;/q;;+2.
What are the key properties of CID 57369962?
CID 57369962 has a molecular weight of 329.18 g/mol, XLogP of 3.45, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57369962 is sourced from PubChem (CID 57369962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).