About CID 73212798
CID 73212798 (PubChem CID 73212798) has the molecular formula C19H14FFeNO+2
and a molecular weight of 347.17 g/mol.
Molecular Properties
| Compound Name | CID 73212798 |
| PubChem CID | 73212798 |
| Molecular Formula | C19H14FFeNO+2 |
| Molecular Weight | 347.17 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | — |
| SMILES | O=C1Nc2ccc(F)cc2/C1=C\[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H9FNO.C5H5.Fe/c15-10-5-6-13-11(8-10)12(14(17)16-13)7-9-3-1-2-4-9;1-2-4-5-3-1;/h1-8H,(H,16,17);1-5H;/q;;+2/b12-7+;; |
| InChIKey | KODUDIXRNTXWPK-CURPJKDSSA-N |
| XLogP | 3.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 73212798 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 73212798?
The IUPAC name of CID 73212798 (CID 73212798) is not available.
What is the SMILES notation for CID 73212798?
The canonical SMILES for CID 73212798 is O=C1Nc2ccc(F)cc2/C1=C\[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 73212798?
The InChIKey is KODUDIXRNTXWPK-CURPJKDSSA-N. The full InChI is InChI=1S/C14H9FNO.C5H5.Fe/c15-10-5-6-13-11(8-10)12(14(17)16-13)7-9-3-1-2-4-9;1-2-4-5-3-1;/h1-8H,(H,16,17);1-5H;/q;;+2/b12-7+;;.
What are the key properties of CID 73212798?
CID 73212798 has a molecular weight of 347.17 g/mol, XLogP of 3.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 73212798 is sourced from PubChem (CID 73212798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).