C21H16FNO — CID 68581049
(3Z)-3-[(1,3-dimethylazulen-2-yl)methylidene]-5-fluoro-1H-indol-2-one (PubChem CID 68581049) has the molecular formula C21H16FNO and a molecular weight of 317.36 g/mol. Its IUPAC name is (3Z)-3-[(1,3-dimethylazulen-2-yl)methylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | (3Z)-3-[(1,3-dimethylazulen-2-yl)methylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 68581049 |
| Molecular Formula | C21H16FNO |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | (3Z)-3-[(1,3-dimethylazulen-2-yl)methylidene]-5-fluoro-1H-indol-2-one |
| SMILES | Cc1c2cccccc-2c(C)c1/C=C1\C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C21H16FNO/c1-12-15-6-4-3-5-7-16(15)13(2)17(12)11-19-18-10-14(22)8-9-20(18)23-21(19)24/h3-11H,1-2H3,(H,23,24)/b19-11- |
| InChIKey | IJYKEBSZRJKSQM-ODLFYWEKSA-N |
| XLogP | 5.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|