C25H25FN2O2 — CID 68580753
3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-5-fluoro-1H-indol-2-one (PubChem CID 68580753) has the molecular formula C25H25FN2O2 and a molecular weight of 404.49 g/mol. Its IUPAC name is 3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-5-fluoro-1H-indol-2-one.
| Compound Name | 3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-5-fluoro-1H-indol-2-one |
|---|---|
| PubChem CID | 68580753 |
| Molecular Formula | C25H25FN2O2 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | 3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-5-fluoro-1H-indol-2-one |
| SMILES | Cc1cc(C=C2C(=O)Nc3ccc(F)cc32)c2ccccc(OCCCN(C)C)c1-2 |
| InChI | InChI=1S/C25H25FN2O2/c1-16-13-17(14-21-20-15-18(26)9-10-22(20)27-25(21)29)19-7-4-5-8-23(24(16)19)30-12-6-11-28(2)3/h4-5,7-10,13-15H,6,11-12H2,1-3H3,(H,27,29) |
| InChIKey | YMXYPDNRDMMODA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|