C33H40N4O4 — CID 68582422
ethyl 4-[[(3Z)-3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]piperidine-1-carboxylate (PubChem CID 68582422) has the molecular formula C33H40N4O4 and a molecular weight of 556.71 g/mol. Its IUPAC name is ethyl 4-[[(3Z)-3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(3Z)-3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 68582422 |
| Molecular Formula | C33H40N4O4 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | ethyl 4-[[(3Z)-3-[[4-[3-(dimethylamino)propoxy]-3-methylazulen-1-yl]methylidene]-2-oxo-1H-indol-6-yl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(Nc2ccc3c(c2)NC(=O)/C3=C\c2cc(C)c3c(OCCCN(C)C)ccccc2-3)CC1 |
| InChI | InChI=1S/C33H40N4O4/c1-5-40-33(39)37-16-13-24(14-17-37)34-25-11-12-27-28(32(38)35-29(27)21-25)20-23-19-22(2)31-26(23)9-6-7-10-30(31)41-18-8-15-36(3)4/h6-7,9-12,19-21,24,34H,5,8,13-18H2,1-4H3,(H,35,38)/b28-20- |
| InChIKey | KYKXCOZOGAKVRP-RRAHZORUSA-N |
| XLogP | 5.96 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|