C25H26Cl2N2O4 — CID 70204549
tert-butyl 4-[4-chloro-2-[(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]piperidine-1-carboxylate (PubChem CID 70204549) has the molecular formula C25H26Cl2N2O4 and a molecular weight of 489.40 g/mol. Its IUPAC name is tert-butyl 4-[4-chloro-2-[(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-chloro-2-[(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 70204549 |
| Molecular Formula | C25H26Cl2N2O4 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | tert-butyl 4-[4-chloro-2-[(6-chloro-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(Cl)cc2C=C2C(=O)Nc3cc(Cl)ccc32)CC1 |
| InChI | InChI=1S/C25H26Cl2N2O4/c1-25(2,3)33-24(31)29-10-8-18(9-11-29)32-22-7-5-16(26)12-15(22)13-20-19-6-4-17(27)14-21(19)28-23(20)30/h4-7,12-14,18H,8-11H2,1-3H3,(H,28,30) |
| InChIKey | LYYJHZMEZSAWJK-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|