C23H27ClFNO3 — CID 167388812
tert-butyl 4-[2-[(4-chloro-2-fluorophenyl)methyl]phenoxy]piperidine-1-carboxylate (PubChem CID 167388812) has the molecular formula C23H27ClFNO3 and a molecular weight of 419.92 g/mol. Its IUPAC name is tert-butyl 4-[2-[(4-chloro-2-fluorophenyl)methyl]phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(4-chloro-2-fluorophenyl)methyl]phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 167388812 |
| Molecular Formula | C23H27ClFNO3 |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | tert-butyl 4-[2-[(4-chloro-2-fluorophenyl)methyl]phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccccc2Cc2ccc(Cl)cc2F)CC1 |
| InChI | InChI=1S/C23H27ClFNO3/c1-23(2,3)29-22(27)26-12-10-19(11-13-26)28-21-7-5-4-6-17(21)14-16-8-9-18(24)15-20(16)25/h4-9,15,19H,10-14H2,1-3H3 |
| InChIKey | KZYBULRMBRPFCW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |