C34H33BrCl2FN3O5 — CID 66640665
tert-butyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-3-fluorophenoxy]piperidine-1-carboxylate (PubChem CID 66640665) has the molecular formula C34H33BrCl2FN3O5 and a molecular weight of 733.46 g/mol. Its IUPAC name is tert-butyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-3-fluorophenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-3-fluorophenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66640665 |
| Molecular Formula | C34H33BrCl2FN3O5 |
| Molecular Weight | 733.46 g/mol |
| Exact Mass | 731.10 |
| IUPAC Name | tert-butyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(3-chlorophenyl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-3-fluorophenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2ccc(Br)c(F)c2[C@@H]2NC(=O)C[C@@H](c3cccc(Cl)c3)[C@]23C(=O)Nc2cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C34H33BrCl2FN3O5/c1-33(2,3)46-32(44)41-13-11-21(12-14-41)45-26-10-9-24(35)29(38)28(26)30-34(22-8-7-20(37)16-25(22)39-31(34)43)23(17-27(42)40-30)18-5-4-6-19(36)15-18/h4-10,15-16,21,23,30H,11-14,17H2,1-3H3,(H,39,43)(H,40,42)/t23-,30-,34-/m0/s1 |
| InChIKey | QYNUHVQINWZYJF-JBJVSMRMSA-N |
| XLogP | 7.91 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.46 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |