C24H16BrCl2IN2O2 — CID 70999482
(3R,4'S,6'S)-6'-(5-bromo-2-iodophenyl)-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 70999482) has the molecular formula C24H16BrCl2IN2O2 and a molecular weight of 642.12 g/mol. Its IUPAC name is (3R,4'S,6'S)-6'-(5-bromo-2-iodophenyl)-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'S)-6'-(5-bromo-2-iodophenyl)-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 70999482 |
| Molecular Formula | C24H16BrCl2IN2O2 |
| Molecular Weight | 642.12 g/mol |
| Exact Mass | 639.88 |
| IUPAC Name | (3R,4'S,6'S)-6'-(5-bromo-2-iodophenyl)-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1C[C@@H](c2cccc(Cl)c2)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](c2cc(Br)ccc2I)N1 |
| InChI | InChI=1S/C24H16BrCl2IN2O2/c25-13-4-7-19(28)16(9-13)22-24(17-6-5-15(27)10-20(17)29-23(24)32)18(11-21(31)30-22)12-2-1-3-14(26)8-12/h1-10,18,22H,11H2,(H,29,32)(H,30,31)/t18-,22+,24-/m0/s1 |
| InChIKey | BNWOBKFCJFAWJW-ANJVHQHFSA-N |
| XLogP | 6.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.12 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|