C24H16Cl2F2N2O2 — CID 68961944
(3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-(2,4-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 68961944) has the molecular formula C24H16Cl2F2N2O2 and a molecular weight of 473.31 g/mol. Its IUPAC name is (3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-(2,4-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-(2,4-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 68961944 |
| Molecular Formula | C24H16Cl2F2N2O2 |
| Molecular Weight | 473.31 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | (3R,4'S,6'R)-6-chloro-4'-(3-chlorophenyl)-6'-(2,4-difluorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1C[C@@H](c2cccc(Cl)c2)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@H](c2ccc(F)cc2F)N1 |
| InChI | InChI=1S/C24H16Cl2F2N2O2/c25-13-3-1-2-12(8-13)18-11-21(31)30-22(16-6-5-15(27)10-19(16)28)24(18)17-7-4-14(26)9-20(17)29-23(24)32/h1-10,18,22H,11H2,(H,29,32)(H,30,31)/t18-,22-,24-/m0/s1 |
| InChIKey | IMAYYCZEUJJUPX-OEOAZWSVSA-N |
| XLogP | 5.51 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.31 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |