C29H26Cl2N2O3Si — CID 76568074
6-chloro-4'-(3-chlorophenyl)-6'-[2-hydroxy-5-(2-trimethylsilylethynyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 76568074) has the molecular formula C29H26Cl2N2O3Si and a molecular weight of 549.53 g/mol. Its IUPAC name is 6-chloro-4'-(3-chlorophenyl)-6'-[2-hydroxy-5-(2-trimethylsilylethynyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 6-chloro-4'-(3-chlorophenyl)-6'-[2-hydroxy-5-(2-trimethylsilylethynyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 76568074 |
| Molecular Formula | C29H26Cl2N2O3Si |
| Molecular Weight | 549.53 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 6-chloro-4'-(3-chlorophenyl)-6'-[2-hydroxy-5-(2-trimethylsilylethynyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C[Si](C)(C)C#Cc1ccc(O)c(C2NC(=O)CC(c3cccc(Cl)c3)C23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C29H26Cl2N2O3Si/c1-37(2,3)12-11-17-7-10-25(34)21(13-17)27-29(22-9-8-20(31)15-24(22)32-28(29)36)23(16-26(35)33-27)18-5-4-6-19(30)14-18/h4-10,13-15,23,27,34H,16H2,1-3H3,(H,32,36)(H,33,35) |
| InChIKey | GAJIJWITVGCHMI-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|