C33H29Cl2N3O4 — CID 74931510
6'-[2-(1-acetylpiperidin-4-yl)oxy-5-ethynylphenyl]-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 74931510) has the molecular formula C33H29Cl2N3O4 and a molecular weight of 602.52 g/mol. Its IUPAC name is 6'-[2-(1-acetylpiperidin-4-yl)oxy-5-ethynylphenyl]-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 6'-[2-(1-acetylpiperidin-4-yl)oxy-5-ethynylphenyl]-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 74931510 |
| Molecular Formula | C33H29Cl2N3O4 |
| Molecular Weight | 602.52 g/mol |
| Exact Mass | 601.15 |
| IUPAC Name | 6'-[2-(1-acetylpiperidin-4-yl)oxy-5-ethynylphenyl]-6-chloro-4'-(3-chlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C#Cc1ccc(OC2CCN(C(C)=O)CC2)c(C2NC(=O)CC(c3cccc(Cl)c3)C23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C33H29Cl2N3O4/c1-3-20-7-10-29(42-24-11-13-38(14-12-24)19(2)39)25(15-20)31-33(26-9-8-23(35)17-28(26)36-32(33)41)27(18-30(40)37-31)21-5-4-6-22(34)16-21/h1,4-10,15-17,24,27,31H,11-14,18H2,2H3,(H,36,41)(H,37,40) |
| InChIKey | NIVPSRMVYJJIMX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|