C33H32Cl2N4O3 — CID 87092037
(3R,4'S,6'R)-6'-[2-[(1-acetylpiperidin-4-yl)amino]-5-ethynylphenyl]-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 87092037) has the molecular formula C33H32Cl2N4O3 and a molecular weight of 603.55 g/mol. Its IUPAC name is (3R,4'S,6'R)-6'-[2-[(1-acetylpiperidin-4-yl)amino]-5-ethynylphenyl]-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,4'S,6'R)-6'-[2-[(1-acetylpiperidin-4-yl)amino]-5-ethynylphenyl]-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 87092037 |
| Molecular Formula | C33H32Cl2N4O3 |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 602.19 |
| IUPAC Name | (3R,4'S,6'R)-6'-[2-[(1-acetylpiperidin-4-yl)amino]-5-ethynylphenyl]-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | C#Cc1ccc(NC2CCN(C(C)=O)CC2)c([C@H]2NC(=O)C[C@@H](C3C=CC=C(Cl)C3)[C@]23C(=O)Nc2cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C33H32Cl2N4O3/c1-3-20-7-10-28(36-24-11-13-39(14-12-24)19(2)40)25(15-20)31-33(26-9-8-23(35)17-29(26)37-32(33)42)27(18-30(41)38-31)21-5-4-6-22(34)16-21/h1,4-10,15,17,21,24,27,31,36H,11-14,16,18H2,2H3,(H,37,42)(H,38,41)/t21?,27-,31+,33-/m0/s1 |
| InChIKey | QBKHXBYXJNWUIH-HFFXRZEMSA-N |
| XLogP | 5.51 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|