C31H25BrCl2N2O4 — CID 173486976
(3R,6'S)-6'-[5-bromo-2-(4-methoxyphenoxy)phenyl]-6-chloro-4'-[(1S)-5-chlorocyclohexa-2,4-dien-1-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 173486976) has the molecular formula C31H25BrCl2N2O4 and a molecular weight of 640.36 g/mol. Its IUPAC name is (3R,6'S)-6'-[5-bromo-2-(4-methoxyphenoxy)phenyl]-6-chloro-4'-[(1S)-5-chlorocyclohexa-2,4-dien-1-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,6'S)-6'-[5-bromo-2-(4-methoxyphenoxy)phenyl]-6-chloro-4'-[(1S)-5-chlorocyclohexa-2,4-dien-1-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 173486976 |
| Molecular Formula | C31H25BrCl2N2O4 |
| Molecular Weight | 640.36 g/mol |
| Exact Mass | 638.04 |
| IUPAC Name | (3R,6'S)-6'-[5-bromo-2-(4-methoxyphenoxy)phenyl]-6-chloro-4'-[(1S)-5-chlorocyclohexa-2,4-dien-1-yl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | COc1ccc(Oc2ccc(Br)cc2[C@@H]2NC(=O)CC([C@@H]3C=CC=C(Cl)C3)[C@]23C(=O)Nc2cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C31H25BrCl2N2O4/c1-39-21-7-9-22(10-8-21)40-27-12-5-18(32)14-23(27)29-31(24-11-6-20(34)15-26(24)35-30(31)38)25(16-28(37)36-29)17-3-2-4-19(33)13-17/h2-12,14-15,17,25,29H,13,16H2,1H3,(H,35,38)(H,36,37)/t17-,25?,29+,31+/m1/s1 |
| InChIKey | ZLNJMEQUMQNMIF-ZSGAQXIMSA-N |
| XLogP | 7.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.36 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |