C35H38Cl2IN3O5 — CID 173005087
tert-butyl 4-[[2-[(2'S,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-4-iodophenoxy]methyl]piperidine-1-carboxylate (PubChem CID 173005087) has the molecular formula C35H38Cl2IN3O5 and a molecular weight of 778.51 g/mol. Its IUPAC name is tert-butyl 4-[[2-[(2'S,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-4-iodophenoxy]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-[(2'S,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-4-iodophenoxy]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 173005087 |
| Molecular Formula | C35H38Cl2IN3O5 |
| Molecular Weight | 778.51 g/mol |
| Exact Mass | 777.12 |
| IUPAC Name | tert-butyl 4-[[2-[(2'S,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]-4-iodophenoxy]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(COc2ccc(I)cc2[C@@H]2NC(=O)C[C@@H](C3C=CC=C(Cl)C3)[C@]23C(=O)Nc2cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C35H38Cl2IN3O5/c1-34(2,3)46-33(44)41-13-11-20(12-14-41)19-45-29-10-8-24(38)17-25(29)31-35(26-9-7-23(37)16-28(26)39-32(35)43)27(18-30(42)40-31)21-5-4-6-22(36)15-21/h4-10,16-17,20-21,27,31H,11-15,18-19H2,1-3H3,(H,39,43)(H,40,42)/t21?,27-,31-,35-/m0/s1 |
| InChIKey | MVWAJTGBJCTNMW-SGZHSNBPSA-N |
| XLogP | 7.74 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 778.51 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|