C25H19Cl2F3N2O2 — CID 70311908
(3R,6'R)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[2-(trifluoromethyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 70311908) has the molecular formula C25H19Cl2F3N2O2 and a molecular weight of 507.34 g/mol. Its IUPAC name is (3R,6'R)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[2-(trifluoromethyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,6'R)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[2-(trifluoromethyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 70311908 |
| Molecular Formula | C25H19Cl2F3N2O2 |
| Molecular Weight | 507.34 g/mol |
| Exact Mass | 506.08 |
| IUPAC Name | (3R,6'R)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-6'-[2-(trifluoromethyl)phenyl]spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1CC(C2C=CC=C(Cl)C2)[C@]2(C(=O)Nc3cc(Cl)ccc32)[C@@H](c2ccccc2C(F)(F)F)N1 |
| InChI | InChI=1S/C25H19Cl2F3N2O2/c26-14-5-3-4-13(10-14)19-12-21(33)32-22(16-6-1-2-7-17(16)25(28,29)30)24(19)18-9-8-15(27)11-20(18)31-23(24)34/h1-9,11,13,19,22H,10,12H2,(H,31,34)(H,32,33)/t13?,19?,22-,24+/m1/s1 |
| InChIKey | GXKSPCGZNFLFSP-VZTWKFOHSA-N |
| XLogP | 6.12 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.34 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |