C20H19ClN2O2 — CID 143538298
(3R,6'R)-6-chloro-6'-(2-ethylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 143538298) has the molecular formula C20H19ClN2O2 and a molecular weight of 354.84 g/mol. Its IUPAC name is (3R,6'R)-6-chloro-6'-(2-ethylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | (3R,6'R)-6-chloro-6'-(2-ethylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 143538298 |
| Molecular Formula | C20H19ClN2O2 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | (3R,6'R)-6-chloro-6'-(2-ethylphenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | CCc1ccccc1[C@H]1NC(=O)CC[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C20H19ClN2O2/c1-2-12-5-3-4-6-14(12)18-20(10-9-17(24)23-18)15-8-7-13(21)11-16(15)22-19(20)25/h3-8,11,18H,2,9-10H2,1H3,(H,22,25)(H,23,24)/t18-,20-/m1/s1 |
| InChIKey | NYUAGZZEXMVQIR-UYAOXDASSA-N |
| XLogP | 3.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |