C17H23ClN2O — CID 143538635
(3R)-6-chloro-2'-pentan-3-ylspiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 143538635) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is (3R)-6-chloro-2'-pentan-3-ylspiro[1H-indole-3,3'-piperidine]-2-one.
| Compound Name | (3R)-6-chloro-2'-pentan-3-ylspiro[1H-indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 143538635 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | (3R)-6-chloro-2'-pentan-3-ylspiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | CCC(CC)C1NCCC[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C17H23ClN2O/c1-3-11(4-2)15-17(8-5-9-19-15)13-7-6-12(18)10-14(13)20-16(17)21/h6-7,10-11,15,19H,3-5,8-9H2,1-2H3,(H,20,21)/t15?,17-/m1/s1 |
| InChIKey | DJPJAQFNQAFSQW-OMOCHNIRSA-N |
| XLogP | 3.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |