C10H9ClN2O — CID 155891599
6-chlorospiro[1H-indole-3,3'-azetidine]-2-one (PubChem CID 155891599) has the molecular formula C10H9ClN2O and a molecular weight of 208.65 g/mol. Its IUPAC name is 6-chlorospiro[1H-indole-3,3'-azetidine]-2-one.
| Compound Name | 6-chlorospiro[1H-indole-3,3'-azetidine]-2-one |
|---|---|
| PubChem CID | 155891599 |
| Molecular Formula | C10H9ClN2O |
| Molecular Weight | 208.65 g/mol |
| Exact Mass | 208.04 |
| IUPAC Name | 6-chlorospiro[1H-indole-3,3'-azetidine]-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2C12CNC2 |
| InChI | InChI=1S/C10H9ClN2O/c11-6-1-2-7-8(3-6)13-9(14)10(7)4-12-5-10/h1-3,12H,4-5H2,(H,13,14) |
| InChIKey | OXKBKRCLZYBZIM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.65 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |