C12H12ClNO2 — CID 106701967
5-chlorospiro[1H-indole-3,4'-oxane]-2-one (PubChem CID 106701967) has the molecular formula C12H12ClNO2 and a molecular weight of 237.69 g/mol. Its IUPAC name is 5-chlorospiro[1H-indole-3,4'-oxane]-2-one.
| Compound Name | 5-chlorospiro[1H-indole-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 106701967 |
| Molecular Formula | C12H12ClNO2 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-chlorospiro[1H-indole-3,4'-oxane]-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C12CCOCC2 |
| InChI | InChI=1S/C12H12ClNO2/c13-8-1-2-10-9(7-8)12(11(15)14-10)3-5-16-6-4-12/h1-2,7H,3-6H2,(H,14,15) |
| InChIKey | VPVIYEFIPRLRNA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |