C11H11ClN2O2 — CID 98041414
(3S)-6-chlorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one (PubChem CID 98041414) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is (3S)-6-chlorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one.
| Compound Name | (3S)-6-chlorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one |
|---|---|
| PubChem CID | 98041414 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | (3S)-6-chlorospiro[1,4-dihydroquinoxaline-3,3'-oxolane]-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2N[C@]12CCOC2 |
| InChI | InChI=1S/C11H11ClN2O2/c12-7-1-2-8-9(5-7)14-11(10(15)13-8)3-4-16-6-11/h1-2,5,14H,3-4,6H2,(H,13,15)/t11-/m0/s1 |
| InChIKey | PVXFMSZRBBDWKH-NSHDSACASA-N |
| XLogP | 1.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |