C12H12ClFN2O2 — CID 114089772
6-chloro-7-fluorospiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-one (PubChem CID 114089772) has the molecular formula C12H12ClFN2O2 and a molecular weight of 270.69 g/mol. Its IUPAC name is 6-chloro-7-fluorospiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-one.
| Compound Name | 6-chloro-7-fluorospiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 114089772 |
| Molecular Formula | C12H12ClFN2O2 |
| Molecular Weight | 270.69 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 6-chloro-7-fluorospiro[1,4-dihydroquinoxaline-3,4'-oxane]-2-one |
| SMILES | O=C1Nc2cc(F)c(Cl)cc2NC12CCOCC2 |
| InChI | InChI=1S/C12H12ClFN2O2/c13-7-5-10-9(6-8(7)14)15-11(17)12(16-10)1-3-18-4-2-12/h5-6,16H,1-4H2,(H,15,17) |
| InChIKey | NYUPMGSNOOMSLS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.69 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |