C10H9ClFNO — CID 163423174
6-chloro-5-fluoro-3,3-dimethyl-1H-indol-2-one (PubChem CID 163423174) has the molecular formula C10H9ClFNO and a molecular weight of 213.64 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 6-chloro-5-fluoro-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 163423174 |
| Molecular Formula | C10H9ClFNO |
| Molecular Weight | 213.64 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 6-chloro-5-fluoro-3,3-dimethyl-1H-indol-2-one |
| SMILES | CC1(C)C(=O)Nc2cc(Cl)c(F)cc21 |
| InChI | InChI=1S/C10H9ClFNO/c1-10(2)5-3-7(12)6(11)4-8(5)13-9(10)14/h3-4H,1-2H3,(H,13,14) |
| InChIKey | AKGAVBMQKBEGNW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.64 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |