C22H22Cl2FN2O+ — CID 140662308
(2'R,3S,4'R)-6-chloro-4'-(3-chlorophenyl)-2'-(2,2-dimethylpropyl)-5-fluorospiro[1H-indole-3,3'-2,4-dihydropyrrol-1-ium]-2-one (PubChem CID 140662308) has the molecular formula C22H22Cl2FN2O+ and a molecular weight of 420.34 g/mol. Its IUPAC name is (2'R,3S,4'R)-6-chloro-4'-(3-chlorophenyl)-2'-(2,2-dimethylpropyl)-5-fluorospiro[1H-indole-3,3'-2,4-dihydropyrrol-1-ium]-2-one.
| Compound Name | (2'R,3S,4'R)-6-chloro-4'-(3-chlorophenyl)-2'-(2,2-dimethylpropyl)-5-fluorospiro[1H-indole-3,3'-2,4-dihydropyrrol-1-ium]-2-one |
|---|---|
| PubChem CID | 140662308 |
| Molecular Formula | C22H22Cl2FN2O+ |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (2'R,3S,4'R)-6-chloro-4'-(3-chlorophenyl)-2'-(2,2-dimethylpropyl)-5-fluorospiro[1H-indole-3,3'-2,4-dihydropyrrol-1-ium]-2-one |
| SMILES | CC(C)(C)C[C@H]1[NH+]=C[C@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C22H21Cl2FN2O/c1-21(2,3)10-19-22(15(11-26-19)12-5-4-6-13(23)7-12)14-8-17(25)16(24)9-18(14)27-20(22)28/h4-9,11,15,19H,10H2,1-3H3,(H,27,28)/p+1/t15-,19-,22-/m1/s1 |
| InChIKey | GZRTWSIQAUBSCW-YIFZBPKDSA-O |
| XLogP | 4.08 |
| TPSA | 43.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |