C30H36Cl2FN3O3 — CID 148767604
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-N-[(4-hydroxycyclohexyl)methyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 148767604) has the molecular formula C30H36Cl2FN3O3 and a molecular weight of 576.54 g/mol. Its IUPAC name is (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-N-[(4-hydroxycyclohexyl)methyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-N-[(4-hydroxycyclohexyl)methyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 148767604 |
| Molecular Formula | C30H36Cl2FN3O3 |
| Molecular Weight | 576.54 g/mol |
| Exact Mass | 575.21 |
| IUPAC Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-N-[(4-hydroxycyclohexyl)methyl]-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)NCC2CCC(O)CC2)[C@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C30H36Cl2FN3O3/c1-29(2,3)14-24-30(20-12-22(33)21(32)13-23(20)35-28(30)39)25(17-5-4-6-18(31)11-17)26(36-24)27(38)34-15-16-7-9-19(37)10-8-16/h4-6,11-13,16,19,24-26,36-37H,7-10,14-15H2,1-3H3,(H,34,38)(H,35,39)/t16?,19?,24-,25+,26-,30+/m1/s1 |
| InChIKey | OHTRDIXSKSXNFE-QCDXHFAXSA-N |
| XLogP | 5.55 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |