C30H36Cl2FN3O2 — CID 70309886
(3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-(2-cyclopentylethyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 70309886) has the molecular formula C30H36Cl2FN3O2 and a molecular weight of 560.54 g/mol. Its IUPAC name is (3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-(2-cyclopentylethyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-(2-cyclopentylethyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 70309886 |
| Molecular Formula | C30H36Cl2FN3O2 |
| Molecular Weight | 560.54 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | (3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-(2-cyclopentylethyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1NC(C(=O)NCCC2CCCC2)[C@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C30H36Cl2FN3O2/c1-29(2,3)16-24-30(20-14-22(33)21(32)15-23(20)35-28(30)38)25(18-9-6-10-19(31)13-18)26(36-24)27(37)34-12-11-17-7-4-5-8-17/h6,9-10,13-15,17,24-26,36H,4-5,7-8,11-12,16H2,1-3H3,(H,34,37)(H,35,38)/t24-,25+,26?,30+/m1/s1 |
| InChIKey | GFIORUXCNDIOHX-XISULHKTSA-N |
| XLogP | 6.58 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |