C30H36Cl2F2N4O2 — CID 143648318
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-N-[2-(cyclopentylamino)ethyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 143648318) has the molecular formula C30H36Cl2F2N4O2 and a molecular weight of 593.55 g/mol. Its IUPAC name is (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-N-[2-(cyclopentylamino)ethyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-N-[2-(cyclopentylamino)ethyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 143648318 |
| Molecular Formula | C30H36Cl2F2N4O2 |
| Molecular Weight | 593.55 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-N-[2-(cyclopentylamino)ethyl]-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(=O)NCCNC2CCCC2)[C@H](c2ccc(F)c(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C30H36Cl2F2N4O2/c1-29(2,3)15-24-30(18-13-22(34)20(32)14-23(18)37-28(30)40)25(16-8-9-21(33)19(31)12-16)26(38-24)27(39)36-11-10-35-17-6-4-5-7-17/h8-9,12-14,17,24-26,35,38H,4-7,10-11,15H2,1-3H3,(H,36,39)(H,37,40)/t24-,25+,26-,30+/m1/s1 |
| InChIKey | YIQFZFRKYWSJEF-PYOQLBSMSA-N |
| XLogP | 5.67 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|