C23H23Cl2F2N3O2 — CID 70309511
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 70309511) has the molecular formula C23H23Cl2F2N3O2 and a molecular weight of 482.36 g/mol. Its IUPAC name is (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 70309511 |
| Molecular Formula | C23H23Cl2F2N3O2 |
| Molecular Weight | 482.36 g/mol |
| Exact Mass | 481.11 |
| IUPAC Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chloro-4-fluorophenyl)-5'-(2,2-dimethylpropyl)-5-fluoro-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(C)C[C@H]1N[C@@H](C(N)=O)[C@H](c2ccc(F)c(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C23H23Cl2F2N3O2/c1-22(2,3)9-17-23(11-7-15(27)13(25)8-16(11)29-21(23)32)18(19(30-17)20(28)31)10-4-5-14(26)12(24)6-10/h4-8,17-19,30H,9H2,1-3H3,(H2,28,31)(H,29,32)/t17-,18+,19-,23+/m1/s1 |
| InChIKey | WTYLLMSBFNSQKV-KCESLBEFSA-N |
| XLogP | 4.51 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.36 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |