C13H15ClN2O — CID 79295398
7-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one (PubChem CID 79295398) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 7-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one.
| Compound Name | 7-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 79295398 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 7-chlorospiro[1,4-dihydroquinoxaline-3,1'-cyclohexane]-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2NC12CCCCC2 |
| InChI | InChI=1S/C13H15ClN2O/c14-9-4-5-10-11(8-9)15-12(17)13(16-10)6-2-1-3-7-13/h4-5,8,16H,1-3,6-7H2,(H,15,17) |
| InChIKey | ZTKXVGUYMYJJQN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |