C10H10ClNO2 — CID 159617645
5-chloro-3-ethyl-3-hydroxy-1H-indol-2-one (PubChem CID 159617645) has the molecular formula C10H10ClNO2 and a molecular weight of 211.65 g/mol. Its IUPAC name is 5-chloro-3-ethyl-3-hydroxy-1H-indol-2-one.
| Compound Name | 5-chloro-3-ethyl-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 159617645 |
| Molecular Formula | C10H10ClNO2 |
| Molecular Weight | 211.65 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 5-chloro-3-ethyl-3-hydroxy-1H-indol-2-one |
| SMILES | CCC1(O)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C10H10ClNO2/c1-2-10(14)7-5-6(11)3-4-8(7)12-9(10)13/h3-5,14H,2H2,1H3,(H,12,13) |
| InChIKey | MNMFXPJUPMZANO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |