C9H9ClN2O2 — CID 130804081
(3S)-3-amino-5-chloro-3-(hydroxymethyl)-1H-indol-2-one (PubChem CID 130804081) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is (3S)-3-amino-5-chloro-3-(hydroxymethyl)-1H-indol-2-one.
| Compound Name | (3S)-3-amino-5-chloro-3-(hydroxymethyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 130804081 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (3S)-3-amino-5-chloro-3-(hydroxymethyl)-1H-indol-2-one |
| SMILES | N[C@@]1(CO)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C9H9ClN2O2/c10-5-1-2-7-6(3-5)9(11,4-13)8(14)12-7/h1-3,13H,4,11H2,(H,12,14)/t9-/m1/s1 |
| InChIKey | PBPXPEHRDKGXAY-SECBINFHSA-N |
| XLogP | 0.44 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |