C20H15ClNO3P — CID 138968426
5-chloro-3-diphenylphosphoryl-3-hydroxy-1H-indol-2-one (PubChem CID 138968426) has the molecular formula C20H15ClNO3P and a molecular weight of 383.77 g/mol. Its IUPAC name is 5-chloro-3-diphenylphosphoryl-3-hydroxy-1H-indol-2-one.
| Compound Name | 5-chloro-3-diphenylphosphoryl-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 138968426 |
| Molecular Formula | C20H15ClNO3P |
| Molecular Weight | 383.77 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 5-chloro-3-diphenylphosphoryl-3-hydroxy-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1(O)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H15ClNO3P/c21-14-11-12-18-17(13-14)20(24,19(23)22-18)26(25,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13,24H,(H,22,23) |
| InChIKey | QXGHROZYUTWGIR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.77 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|