C14H10ClNO4 — CID 886897
(3R)-5-chloro-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one (PubChem CID 886897) has the molecular formula C14H10ClNO4 and a molecular weight of 291.69 g/mol. Its IUPAC name is (3R)-5-chloro-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one.
| Compound Name | (3R)-5-chloro-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 886897 |
| Molecular Formula | C14H10ClNO4 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (3R)-5-chloro-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)Nc2ccc(Cl)cc21)c1ccco1 |
| InChI | InChI=1S/C14H10ClNO4/c15-8-3-4-10-9(6-8)14(19,13(18)16-10)7-11(17)12-2-1-5-20-12/h1-6,19H,7H2,(H,16,18)/t14-/m1/s1 |
| InChIKey | OSJMDKCPZXXNAG-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |