C14H11NO4 — CID 2255217
(3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one (PubChem CID 2255217) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one.
| Compound Name | (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 2255217 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (3R)-3-[2-(furan-2-yl)-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
| SMILES | O=C(C[C@]1(O)C(=O)Nc2ccccc21)c1ccco1 |
| InChI | InChI=1S/C14H11NO4/c16-11(12-6-3-7-19-12)8-14(18)9-4-1-2-5-10(9)15-13(14)17/h1-7,18H,8H2,(H,15,17)/t14-/m1/s1 |
| InChIKey | CZBKDUWRJUBULO-CQSZACIVSA-N |
| XLogP | 1.69 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |