C20H14ClNO4 — CID 41368279
(3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-3-hydroxy-1H-indol-2-one (PubChem CID 41368279) has the molecular formula C20H14ClNO4 and a molecular weight of 367.79 g/mol. Its IUPAC name is (3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-3-hydroxy-1H-indol-2-one.
| Compound Name | (3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 41368279 |
| Molecular Formula | C20H14ClNO4 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | (3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-3-hydroxy-1H-indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)Nc2ccccc21)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H14ClNO4/c21-13-7-5-12(6-8-13)17-9-10-18(26-17)16(23)11-20(25)14-3-1-2-4-15(14)22-19(20)24/h1-10,25H,11H2,(H,22,24)/t20-/m0/s1 |
| InChIKey | QMDMVTVKANLMEV-FQEVSTJZSA-N |
| XLogP | 4.01 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |