C20H13ClFNO4 — CID 92733862
(3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-5-fluoro-3-hydroxy-1H-indol-2-one (PubChem CID 92733862) has the molecular formula C20H13ClFNO4 and a molecular weight of 385.78 g/mol. Its IUPAC name is (3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-5-fluoro-3-hydroxy-1H-indol-2-one.
| Compound Name | (3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-5-fluoro-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 92733862 |
| Molecular Formula | C20H13ClFNO4 |
| Molecular Weight | 385.78 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | (3S)-3-[2-[5-(4-chlorophenyl)furan-2-yl]-2-oxoethyl]-5-fluoro-3-hydroxy-1H-indol-2-one |
| SMILES | O=C(C[C@@]1(O)C(=O)Nc2ccc(F)cc21)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H13ClFNO4/c21-12-3-1-11(2-4-12)17-7-8-18(27-17)16(24)10-20(26)14-9-13(22)5-6-15(14)23-19(20)25/h1-9,26H,10H2,(H,23,25)/t20-/m0/s1 |
| InChIKey | XEMFHWFXWLFASG-FQEVSTJZSA-N |
| XLogP | 4.15 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |