C13H14FNO5 — CID 102435621
(3R)-3-(3,3-dimethoxy-2-oxopropyl)-5-fluoro-3-hydroxy-1H-indol-2-one (PubChem CID 102435621) has the molecular formula C13H14FNO5 and a molecular weight of 283.25 g/mol. Its IUPAC name is (3R)-3-(3,3-dimethoxy-2-oxopropyl)-5-fluoro-3-hydroxy-1H-indol-2-one.
| Compound Name | (3R)-3-(3,3-dimethoxy-2-oxopropyl)-5-fluoro-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 102435621 |
| Molecular Formula | C13H14FNO5 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (3R)-3-(3,3-dimethoxy-2-oxopropyl)-5-fluoro-3-hydroxy-1H-indol-2-one |
| SMILES | COC(OC)C(=O)C[C@]1(O)C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C13H14FNO5/c1-19-11(20-2)10(16)6-13(18)8-5-7(14)3-4-9(8)15-12(13)17/h3-5,11,18H,6H2,1-2H3,(H,15,17)/t13-/m1/s1 |
| InChIKey | XXHXTFULSPWLIP-CYBMUJFWSA-N |
| XLogP | 0.54 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|