C10H10FNO3 — CID 162744174
5-fluoro-3,3-dimethoxy-1H-indol-2-one (PubChem CID 162744174) has the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. Its IUPAC name is 5-fluoro-3,3-dimethoxy-1H-indol-2-one.
| Compound Name | 5-fluoro-3,3-dimethoxy-1H-indol-2-one |
|---|---|
| PubChem CID | 162744174 |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | 5-fluoro-3,3-dimethoxy-1H-indol-2-one |
| SMILES | COC1(OC)C(=O)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C10H10FNO3/c1-14-10(15-2)7-5-6(11)3-4-8(7)12-9(10)13/h3-5H,1-2H3,(H,12,13) |
| InChIKey | UIJWPQIMXKZHFP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|