C19H19FN2O3 — CID 52995768
2'-(3,5-dimethoxyphenyl)-5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one (PubChem CID 52995768) has the molecular formula C19H19FN2O3 and a molecular weight of 342.37 g/mol. Its IUPAC name is 2'-(3,5-dimethoxyphenyl)-5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one.
| Compound Name | 2'-(3,5-dimethoxyphenyl)-5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
|---|---|
| PubChem CID | 52995768 |
| Molecular Formula | C19H19FN2O3 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 2'-(3,5-dimethoxyphenyl)-5-fluorospiro[1H-indole-3,3'-pyrrolidine]-2-one |
| SMILES | COc1cc(OC)cc(C2NCCC23C(=O)Nc2ccc(F)cc23)c1 |
| InChI | InChI=1S/C19H19FN2O3/c1-24-13-7-11(8-14(10-13)25-2)17-19(5-6-21-17)15-9-12(20)3-4-16(15)22-18(19)23/h3-4,7-10,17,21H,5-6H2,1-2H3,(H,22,23) |
| InChIKey | IIMARLGIJHJGPN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |