C11H10FNO2 — CID 124681361
(3R)-5-fluorospiro[1H-indole-3,3'-oxolane]-2-one (PubChem CID 124681361) has the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. Its IUPAC name is (3R)-5-fluorospiro[1H-indole-3,3'-oxolane]-2-one.
| Compound Name | (3R)-5-fluorospiro[1H-indole-3,3'-oxolane]-2-one |
|---|---|
| PubChem CID | 124681361 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | (3R)-5-fluorospiro[1H-indole-3,3'-oxolane]-2-one |
| SMILES | O=C1Nc2ccc(F)cc2[C@@]12CCOC2 |
| InChI | InChI=1S/C11H10FNO2/c12-7-1-2-9-8(5-7)11(10(14)13-9)3-4-15-6-11/h1-2,5H,3-4,6H2,(H,13,14)/t11-/m0/s1 |
| InChIKey | UBNZSGGTYFYOQL-NSHDSACASA-N |
| XLogP | 1.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |