C14H15FO2 — CID 115010930
7-fluorospiro[3,4-dihydronaphthalene-1,4'-oxane]-2-one (PubChem CID 115010930) has the molecular formula C14H15FO2 and a molecular weight of 234.27 g/mol. Its IUPAC name is 7-fluorospiro[3,4-dihydronaphthalene-1,4'-oxane]-2-one.
| Compound Name | 7-fluorospiro[3,4-dihydronaphthalene-1,4'-oxane]-2-one |
|---|---|
| PubChem CID | 115010930 |
| Molecular Formula | C14H15FO2 |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 7-fluorospiro[3,4-dihydronaphthalene-1,4'-oxane]-2-one |
| SMILES | O=C1CCc2ccc(F)cc2C12CCOCC2 |
| InChI | InChI=1S/C14H15FO2/c15-11-3-1-10-2-4-13(16)14(12(10)9-11)5-7-17-8-6-14/h1,3,9H,2,4-8H2 |
| InChIKey | LZMPTANUFRDLJL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |