About 1-bromo-6-fluoro-2,3-dihydroinden-1-ol
1-bromo-6-fluoro-2,3-dihydroinden-1-ol (PubChem CID 174726827) has the molecular formula C9H8BrFO
and a molecular weight of 231.06 g/mol. Its IUPAC name is 1-bromo-6-fluoro-2,3-dihydroinden-1-ol.
Molecular Properties
| Compound Name | 1-bromo-6-fluoro-2,3-dihydroinden-1-ol |
| PubChem CID | 174726827 |
| Molecular Formula | C9H8BrFO |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 1-bromo-6-fluoro-2,3-dihydroinden-1-ol |
| SMILES | OC1(Br)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C9H8BrFO/c10-9(12)4-3-6-1-2-7(11)5-8(6)9/h1-2,5,12H,3-4H2 |
| InChIKey | QJAGMQFYNGEFDI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-6-fluoro-2,3-dihydroinden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-6-fluoro-2,3-dihydroinden-1-ol?
The IUPAC name of 1-bromo-6-fluoro-2,3-dihydroinden-1-ol (CID 174726827) is 1-bromo-6-fluoro-2,3-dihydroinden-1-ol.
What is the SMILES notation for 1-bromo-6-fluoro-2,3-dihydroinden-1-ol?
The canonical SMILES for 1-bromo-6-fluoro-2,3-dihydroinden-1-ol is OC1(Br)CCc2ccc(F)cc21.
What is the InChIKey of 1-bromo-6-fluoro-2,3-dihydroinden-1-ol?
The InChIKey is QJAGMQFYNGEFDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrFO/c10-9(12)4-3-6-1-2-7(11)5-8(6)9/h1-2,5,12H,3-4H2.
What are the key properties of 1-bromo-6-fluoro-2,3-dihydroinden-1-ol?
1-bromo-6-fluoro-2,3-dihydroinden-1-ol has a molecular weight of 231.06 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-6-fluoro-2,3-dihydroinden-1-ol is sourced from PubChem (CID 174726827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).