C9H8BrFO — CID 174726827
1-bromo-6-fluoro-2,3-dihydroinden-1-ol (PubChem CID 174726827) has the molecular formula C9H8BrFO and a molecular weight of 231.06 g/mol. Its IUPAC name is 1-bromo-6-fluoro-2,3-dihydroinden-1-ol.
| Compound Name | 1-bromo-6-fluoro-2,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 174726827 |
| Molecular Formula | C9H8BrFO |
| Molecular Weight | 231.06 g/mol |
| Exact Mass | 229.97 |
| IUPAC Name | 1-bromo-6-fluoro-2,3-dihydroinden-1-ol |
| SMILES | OC1(Br)CCc2ccc(F)cc21 |
| InChI | InChI=1S/C9H8BrFO/c10-9(12)4-3-6-1-2-7(11)5-8(6)9/h1-2,5,12H,3-4H2 |
| InChIKey | QJAGMQFYNGEFDI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.06 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|