C13H13BrO2 — CID 58154272
6-bromospiro[1H-indene-3,4'-oxane]-2-one (PubChem CID 58154272) has the molecular formula C13H13BrO2 and a molecular weight of 281.15 g/mol. Its IUPAC name is 6-bromospiro[1H-indene-3,4'-oxane]-2-one.
| Compound Name | 6-bromospiro[1H-indene-3,4'-oxane]-2-one |
|---|---|
| PubChem CID | 58154272 |
| Molecular Formula | C13H13BrO2 |
| Molecular Weight | 281.15 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 6-bromospiro[1H-indene-3,4'-oxane]-2-one |
| SMILES | O=C1Cc2cc(Br)ccc2C12CCOCC2 |
| InChI | InChI=1S/C13H13BrO2/c14-10-1-2-11-9(7-10)8-12(15)13(11)3-5-16-6-4-13/h1-2,7H,3-6,8H2 |
| InChIKey | QQQLFBDSQPMQBH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.15 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |